About fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole
fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole (PubChem CID 177040028) has the molecular formula C14H23FN2
and a molecular weight of 238.35 g/mol. Its IUPAC name is fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole.
Molecular Properties
| Compound Name | fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole |
| PubChem CID | 177040028 |
| Molecular Formula | C14H23FN2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole |
| SMILES | CC/C=C(\C)c1nn(C)cc1C=C(C)C.CF |
| InChI | InChI=1S/C13H20N2.CH3F/c1-6-7-11(4)13-12(8-10(2)3)9-15(5)14-13;1-2/h7-9H,6H2,1-5H3;1H3/b11-7+; |
| InChIKey | GSLVUMNEYISHKJ-RVDQCCQOSA-N |
| XLogP | 4.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole?
The IUPAC name of fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole (CID 177040028) is fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole.
What is the SMILES notation for fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole?
The canonical SMILES for fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole is CC/C=C(\C)c1nn(C)cc1C=C(C)C.CF.
What is the InChIKey of fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole?
The InChIKey is GSLVUMNEYISHKJ-RVDQCCQOSA-N. The full InChI is InChI=1S/C13H20N2.CH3F/c1-6-7-11(4)13-12(8-10(2)3)9-15(5)14-13;1-2/h7-9H,6H2,1-5H3;1H3/b11-7+;.
What are the key properties of fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole?
fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole has a molecular weight of 238.35 g/mol, XLogP of 4.24, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;1-methyl-4-(2-methylprop-1-enyl)-3-[(E)-pent-2-en-2-yl]pyrazole is sourced from PubChem (CID 177040028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).