About 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium
7-fluoro-2,5-dimethyl-3aH-indazol-2-ium (PubChem CID 177040391) has the molecular formula C9H10FN2+
and a molecular weight of 165.19 g/mol. Its IUPAC name is 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium.
Molecular Properties
| Compound Name | 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium |
| PubChem CID | 177040391 |
| Molecular Formula | C9H10FN2+ |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium |
| SMILES | CC1=CC2C=[N+](C)N=C2C(F)=C1 |
| InChI | InChI=1S/C9H10FN2/c1-6-3-7-5-12(2)11-9(7)8(10)4-6/h3-5,7H,1-2H3/q+1 |
| InChIKey | ABJGBBSFTYSQPN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium?
The IUPAC name of 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium (CID 177040391) is 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium.
What is the SMILES notation for 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium?
The canonical SMILES for 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium is CC1=CC2C=[N+](C)N=C2C(F)=C1.
What is the InChIKey of 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium?
The InChIKey is ABJGBBSFTYSQPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN2/c1-6-3-7-5-12(2)11-9(7)8(10)4-6/h3-5,7H,1-2H3/q+1.
What are the key properties of 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium?
7-fluoro-2,5-dimethyl-3aH-indazol-2-ium has a molecular weight of 165.19 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-2,5-dimethyl-3aH-indazol-2-ium is sourced from PubChem (CID 177040391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).