About N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide
N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide (PubChem CID 177040421) has the molecular formula C13H17FN2O
and a molecular weight of 236.29 g/mol. Its IUPAC name is N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide.
Molecular Properties
| Compound Name | N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide |
| PubChem CID | 177040421 |
| Molecular Formula | C13H17FN2O |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide |
| SMILES | C/C=C1/C=C(NC(=O)CCC)C(F)=C/C1=N\C |
| InChI | InChI=1S/C13H17FN2O/c1-4-6-13(17)16-12-7-9(5-2)11(15-3)8-10(12)14/h5,7-8H,4,6H2,1-3H3,(H,16,17)/b9-5-,15-11+ |
| InChIKey | NCTSCYYVEIWOER-QXJCPRNYSA-N |
| XLogP | 2.67 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide?
The IUPAC name of N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide (CID 177040421) is N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide.
What is the SMILES notation for N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide?
The canonical SMILES for N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide is C/C=C1/C=C(NC(=O)CCC)C(F)=C/C1=N\C.
What is the InChIKey of N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide?
The InChIKey is NCTSCYYVEIWOER-QXJCPRNYSA-N. The full InChI is InChI=1S/C13H17FN2O/c1-4-6-13(17)16-12-7-9(5-2)11(15-3)8-10(12)14/h5,7-8H,4,6H2,1-3H3,(H,16,17)/b9-5-,15-11+.
What are the key properties of N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide?
N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide has a molecular weight of 236.29 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-3-ethylidene-6-fluoro-4-methyliminocyclohexa-1,5-dien-1-yl]butanamide is sourced from PubChem (CID 177040421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).