C19H30FNO — CID 177040586
N-[(7E,9E,11Z)-9-fluoro-2,11-dimethylpentadeca-2,7,9,11-tetraen-8-yl]acetamide (PubChem CID 177040586) has the molecular formula C19H30FNO and a molecular weight of 307.45 g/mol. Its IUPAC name is N-[(7E,9E,11Z)-9-fluoro-2,11-dimethylpentadeca-2,7,9,11-tetraen-8-yl]acetamide.
| Compound Name | N-[(7E,9E,11Z)-9-fluoro-2,11-dimethylpentadeca-2,7,9,11-tetraen-8-yl]acetamide |
|---|---|
| PubChem CID | 177040586 |
| Molecular Formula | C19H30FNO |
| Molecular Weight | 307.45 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | N-[(7E,9E,11Z)-9-fluoro-2,11-dimethylpentadeca-2,7,9,11-tetraen-8-yl]acetamide |
| SMILES | CCC/C=C(C)\C=C(F)/C(=C\CCCC=C(C)C)NC(C)=O |
| InChI | InChI=1S/C19H30FNO/c1-6-7-12-16(4)14-18(20)19(21-17(5)22)13-10-8-9-11-15(2)3/h11-14H,6-10H2,1-5H3,(H,21,22)/b16-12-,18-14+,19-13+ |
| InChIKey | VWEPSDRLWBWVEP-QRVRAVQDSA-N |
| XLogP | 5.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|