About 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium
6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium (PubChem CID 177040796) has the molecular formula C10H10BrF2N2Pd-
and a molecular weight of 382.52 g/mol. Its IUPAC name is 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium.
Molecular Properties
| Compound Name | 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium |
| PubChem CID | 177040796 |
| Molecular Formula | C10H10BrF2N2Pd- |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 380.90 |
| IUPAC Name | 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium |
| SMILES | CC.FC(F)c1cc2n[c-]cn2cc1Br.[Pd] |
| InChI | InChI=1S/C8H4BrF2N2.C2H6.Pd/c9-6-4-13-2-1-12-7(13)3-5(6)8(10)11;1-2;/h2-4,8H;1-2H3;/q-1;; |
| InChIKey | BKMZTTPPZVRLNP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium?
The IUPAC name of 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium (CID 177040796) is 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium.
What is the SMILES notation for 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium?
The canonical SMILES for 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium is CC.FC(F)c1cc2n[c-]cn2cc1Br.[Pd].
What is the InChIKey of 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium?
The InChIKey is BKMZTTPPZVRLNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrF2N2.C2H6.Pd/c9-6-4-13-2-1-12-7(13)3-5(6)8(10)11;1-2;/h2-4,8H;1-2H3;/q-1;;.
What are the key properties of 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium?
6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium has a molecular weight of 382.52 g/mol, XLogP of 3.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-(difluoromethyl)-2H-imidazo[1,2-a]pyridin-2-ide;ethane;palladium is sourced from PubChem (CID 177040796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).