About (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane
(4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane (PubChem CID 177040942) has the molecular formula C15H26FN
and a molecular weight of 239.38 g/mol. Its IUPAC name is (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane.
Molecular Properties
| Compound Name | (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane |
| PubChem CID | 177040942 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane |
| SMILES | C/C=C(C)\N=C(\C=C(F)/C(C)=C\C)CC.CC |
| InChI | InChI=1S/C13H20FN.C2H6/c1-6-10(4)13(14)9-12(8-3)15-11(5)7-2;1-2/h6-7,9H,8H2,1-5H3;1-2H3/b10-6-,11-7-,13-9+,15-12+; |
| InChIKey | ROCVCRSTECHGTA-KGQPQJEXSA-N |
| XLogP | 5.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane?
The IUPAC name of (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane (CID 177040942) is (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane.
What is the SMILES notation for (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane?
The canonical SMILES for (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane is C/C=C(C)\N=C(\C=C(F)/C(C)=C\C)CC.CC.
What is the InChIKey of (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane?
The InChIKey is ROCVCRSTECHGTA-KGQPQJEXSA-N. The full InChI is InChI=1S/C13H20FN.C2H6/c1-6-10(4)13(14)9-12(8-3)15-11(5)7-2;1-2/h6-7,9H,8H2,1-5H3;1-2H3/b10-6-,11-7-,13-9+,15-12+;.
What are the key properties of (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane?
(4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane has a molecular weight of 239.38 g/mol, XLogP of 5.61, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,6Z)-N-[(Z)-but-2-en-2-yl]-5-fluoro-6-methylocta-4,6-dien-3-imine;ethane is sourced from PubChem (CID 177040942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).