About 4-methyl-7H-pyrido[3,2-b]azepine
4-methyl-7H-pyrido[3,2-b]azepine (PubChem CID 177041007) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 4-methyl-7H-pyrido[3,2-b]azepine.
Molecular Properties
| Compound Name | 4-methyl-7H-pyrido[3,2-b]azepine |
| PubChem CID | 177041007 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | 4-methyl-7H-pyrido[3,2-b]azepine |
| SMILES | Cc1ccnc2c1N=CCC=C2 |
| InChI | InChI=1S/C10H10N2/c1-8-5-7-11-9-4-2-3-6-12-10(8)9/h2,4-7H,3H2,1H3 |
| InChIKey | XLXXPEJIXYKZTF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-7H-pyrido[3,2-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-7H-pyrido[3,2-b]azepine?
The IUPAC name of 4-methyl-7H-pyrido[3,2-b]azepine (CID 177041007) is 4-methyl-7H-pyrido[3,2-b]azepine.
What is the SMILES notation for 4-methyl-7H-pyrido[3,2-b]azepine?
The canonical SMILES for 4-methyl-7H-pyrido[3,2-b]azepine is Cc1ccnc2c1N=CCC=C2.
What is the InChIKey of 4-methyl-7H-pyrido[3,2-b]azepine?
The InChIKey is XLXXPEJIXYKZTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-8-5-7-11-9-4-2-3-6-12-10(8)9/h2,4-7H,3H2,1H3.
What are the key properties of 4-methyl-7H-pyrido[3,2-b]azepine?
4-methyl-7H-pyrido[3,2-b]azepine has a molecular weight of 158.20 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-7H-pyrido[3,2-b]azepine is sourced from PubChem (CID 177041007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).