About (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen
(Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen (PubChem CID 177041020) has the molecular formula C14H17FN2
and a molecular weight of 232.30 g/mol. Its IUPAC name is (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen.
Molecular Properties
| Compound Name | (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen |
| PubChem CID | 177041020 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen |
| SMILES | C#Cc1cn2cc(C)nc2cc1F.C/C=C\C.[H][H] |
| InChI | InChI=1S/C10H7FN2.C4H8.H2/c1-3-8-6-13-5-7(2)12-10(13)4-9(8)11;1-3-4-2;/h1,4-6H,2H3;3-4H,1-2H3;1H/b;4-3-; |
| InChIKey | SBAZTYZADCIXBU-LWFKIUJUSA-N |
| XLogP | 3.59 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen?
The IUPAC name of (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen (CID 177041020) is (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen.
What is the SMILES notation for (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen?
The canonical SMILES for (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen is C#Cc1cn2cc(C)nc2cc1F.C/C=C\C.[H][H].
What is the InChIKey of (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen?
The InChIKey is SBAZTYZADCIXBU-LWFKIUJUSA-N. The full InChI is InChI=1S/C10H7FN2.C4H8.H2/c1-3-8-6-13-5-7(2)12-10(13)4-9(8)11;1-3-4-2;/h1,4-6H,2H3;3-4H,1-2H3;1H/b;4-3-;.
What are the key properties of (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen?
(Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen has a molecular weight of 232.30 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;6-ethynyl-7-fluoro-2-methylimidazo[1,2-a]pyridine;molecular hydrogen is sourced from PubChem (CID 177041020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).