About 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine
6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine (PubChem CID 177041025) has the molecular formula C6H6FN3
and a molecular weight of 139.13 g/mol. Its IUPAC name is 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine |
| PubChem CID | 177041025 |
| Molecular Formula | C6H6FN3 |
| Molecular Weight | 139.13 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine |
| SMILES | [H]/N=C1\C=C(N)C(F)=C\C1=N/[H] |
| InChI | InChI=1S/C6H6FN3/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H,8H2/b9-5+,10-6+ |
| InChIKey | DJGDCDGPTFTXHE-NXZHAISVSA-N |
| XLogP | 0.74 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.13 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine?
The IUPAC name of 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine (CID 177041025) is 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine?
The canonical SMILES for 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine is [H]/N=C1\C=C(N)C(F)=C\C1=N/[H].
What is the InChIKey of 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine?
The InChIKey is DJGDCDGPTFTXHE-NXZHAISVSA-N. The full InChI is InChI=1S/C6H6FN3/c7-3-1-5(9)6(10)2-4(3)8/h1-2,9-10H,8H2/b9-5+,10-6+.
What are the key properties of 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine?
6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine has a molecular weight of 139.13 g/mol, XLogP of 0.74, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,4-diiminocyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 177041025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).