C12H21N3O3 — CID 177041199
2-methylbutan-2-yl N-[(3E,5E)-5-hydrazinylidene-2-methoxypenta-1,3-dien-3-yl]carbamate (PubChem CID 177041199) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-methylbutan-2-yl N-[(3E,5E)-5-hydrazinylidene-2-methoxypenta-1,3-dien-3-yl]carbamate.
| Compound Name | 2-methylbutan-2-yl N-[(3E,5E)-5-hydrazinylidene-2-methoxypenta-1,3-dien-3-yl]carbamate |
|---|---|
| PubChem CID | 177041199 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-methylbutan-2-yl N-[(3E,5E)-5-hydrazinylidene-2-methoxypenta-1,3-dien-3-yl]carbamate |
| SMILES | C=C(OC)/C(=C\C=N\N)NC(=O)OC(C)(C)CC |
| InChI | InChI=1S/C12H21N3O3/c1-6-12(3,4)18-11(16)15-10(7-8-14-13)9(2)17-5/h7-8H,2,6,13H2,1,3-5H3,(H,15,16)/b10-7+,14-8+ |
| InChIKey | STDLSOWCAALPOQ-XFUBVATKSA-N |
| XLogP | 1.89 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|