About (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine
(5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine (PubChem CID 177041311) has the molecular formula C16H26FN
and a molecular weight of 251.39 g/mol. Its IUPAC name is (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine.
Molecular Properties
| Compound Name | (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine |
| PubChem CID | 177041311 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine |
| SMILES | C/C=C(\C=C(F)/C(=N/C(C)=C\C)C(C)CC)CC |
| InChI | InChI=1S/C16H26FN/c1-7-12(5)16(18-13(6)8-2)15(17)11-14(9-3)10-4/h8-9,11-12H,7,10H2,1-6H3/b13-8-,14-9-,15-11+,18-16+ |
| InChIKey | FUHMYQKLABIJJB-YZRXXYNNSA-N |
| XLogP | 5.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine?
The IUPAC name of (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine (CID 177041311) is (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine.
What is the SMILES notation for (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine?
The canonical SMILES for (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine is C/C=C(\C=C(F)/C(=N/C(C)=C\C)C(C)CC)CC.
What is the InChIKey of (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine?
The InChIKey is FUHMYQKLABIJJB-YZRXXYNNSA-N. The full InChI is InChI=1S/C16H26FN/c1-7-12(5)16(18-13(6)8-2)15(17)11-14(9-3)10-4/h8-9,11-12H,7,10H2,1-6H3/b13-8-,14-9-,15-11+,18-16+.
What are the key properties of (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine?
(5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine has a molecular weight of 251.39 g/mol, XLogP of 5.61, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E,7Z)-N-[(Z)-but-2-en-2-yl]-7-ethyl-5-fluoro-3-methylnona-5,7-dien-4-imine is sourced from PubChem (CID 177041311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).