About 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one
5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one (PubChem CID 177042134) has the molecular formula C7H13N3O
and a molecular weight of 155.20 g/mol. Its IUPAC name is 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one.
Molecular Properties
| Compound Name | 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one |
| PubChem CID | 177042134 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one |
| SMILES | CN1CCNC(=O)C12CNC2 |
| InChI | InChI=1S/C7H13N3O/c1-10-3-2-9-6(11)7(10)4-8-5-7/h8H,2-5H2,1H3,(H,9,11) |
| InChIKey | DWPWXYSWPWOASY-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one?
The IUPAC name of 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one (CID 177042134) is 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one.
What is the SMILES notation for 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one?
The canonical SMILES for 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one is CN1CCNC(=O)C12CNC2.
What is the InChIKey of 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one?
The InChIKey is DWPWXYSWPWOASY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O/c1-10-3-2-9-6(11)7(10)4-8-5-7/h8H,2-5H2,1H3,(H,9,11).
What are the key properties of 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one?
5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one has a molecular weight of 155.20 g/mol, XLogP of -1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,5,8-triazaspiro[3.5]nonan-9-one is sourced from PubChem (CID 177042134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).