C26H31N5O4 — CID 177042308
3-methoxy-3-(8-methoxy-4-oxo-3H-quinazolin-2-yl)-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]prop-2-enamide (PubChem CID 177042308) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is 3-methoxy-3-(8-methoxy-4-oxo-3H-quinazolin-2-yl)-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]prop-2-enamide.
| Compound Name | 3-methoxy-3-(8-methoxy-4-oxo-3H-quinazolin-2-yl)-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 177042308 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 3-methoxy-3-(8-methoxy-4-oxo-3H-quinazolin-2-yl)-N-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]prop-2-enamide |
| SMILES | COC(=CC(=O)NCc1ccc(CN2CCN(C)CC2)cc1)c1nc2c(OC)cccc2c(=O)[nH]1 |
| InChI | InChI=1S/C26H31N5O4/c1-30-11-13-31(14-12-30)17-19-9-7-18(8-10-19)16-27-23(32)15-22(35-3)25-28-24-20(26(33)29-25)5-4-6-21(24)34-2/h4-10,15H,11-14,16-17H2,1-3H3,(H,27,32)(H,28,29,33) |
| InChIKey | XIZIVEXFHCDSGU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|