C14H12Cl2N4O4 — CID 177042722
methyl 4-amino-5-(4-amino-6-chloro-5-methoxycarbonyl-3-pyridinyl)-2-chloropyridine-3-carboxylate (PubChem CID 177042722) has the molecular formula C14H12Cl2N4O4 and a molecular weight of 371.18 g/mol. Its IUPAC name is methyl 4-amino-5-(4-amino-6-chloro-5-methoxycarbonyl-3-pyridinyl)-2-chloropyridine-3-carboxylate.
| Compound Name | methyl 4-amino-5-(4-amino-6-chloro-5-methoxycarbonyl-3-pyridinyl)-2-chloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 177042722 |
| Molecular Formula | C14H12Cl2N4O4 |
| Molecular Weight | 371.18 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | methyl 4-amino-5-(4-amino-6-chloro-5-methoxycarbonyl-3-pyridinyl)-2-chloropyridine-3-carboxylate |
| SMILES | COC(=O)c1c(Cl)ncc(-c2cnc(Cl)c(C(=O)OC)c2N)c1N |
| InChI | InChI=1S/C14H12Cl2N4O4/c1-23-13(21)7-9(17)5(3-19-11(7)15)6-4-20-12(16)8(10(6)18)14(22)24-2/h3-4H,1-2H3,(H2,17,19)(H2,18,20) |
| InChIKey | QYLCNYVAVWLLLA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 130.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|