C17H16F3N5O2 — CID 177042786
7-amino-6-(3-hydroxy-2,6-dimethylphenyl)-2-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxamide (PubChem CID 177042786) has the molecular formula C17H16F3N5O2 and a molecular weight of 379.34 g/mol. Its IUPAC name is 7-amino-6-(3-hydroxy-2,6-dimethylphenyl)-2-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxamide.
| Compound Name | 7-amino-6-(3-hydroxy-2,6-dimethylphenyl)-2-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxamide |
|---|---|
| PubChem CID | 177042786 |
| Molecular Formula | C17H16F3N5O2 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 7-amino-6-(3-hydroxy-2,6-dimethylphenyl)-2-(2,2,2-trifluoroethyl)-[1,2,4]triazolo[1,5-a]pyridine-8-carboxamide |
| SMILES | Cc1ccc(O)c(C)c1-c1cn2nc(CC(F)(F)F)nc2c(C(N)=O)c1N |
| InChI | InChI=1S/C17H16F3N5O2/c1-7-3-4-10(26)8(2)12(7)9-6-25-16(13(14(9)21)15(22)27)23-11(24-25)5-17(18,19)20/h3-4,6,26H,5,21H2,1-2H3,(H2,22,27) |
| InChIKey | YVWPLKAHUICFEA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 119.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |