C12H9ClF3NO5 — CID 177043636
methyl 2-chloro-3-(2-oxoethylcarbamoyl)-4-(trifluoromethoxy)benzoate (PubChem CID 177043636) has the molecular formula C12H9ClF3NO5 and a molecular weight of 339.65 g/mol. Its IUPAC name is methyl 2-chloro-3-(2-oxoethylcarbamoyl)-4-(trifluoromethoxy)benzoate.
| Compound Name | methyl 2-chloro-3-(2-oxoethylcarbamoyl)-4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 177043636 |
| Molecular Formula | C12H9ClF3NO5 |
| Molecular Weight | 339.65 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | methyl 2-chloro-3-(2-oxoethylcarbamoyl)-4-(trifluoromethoxy)benzoate |
| SMILES | COC(=O)c1ccc(OC(F)(F)F)c(C(=O)NCC=O)c1Cl |
| InChI | InChI=1S/C12H9ClF3NO5/c1-21-11(20)6-2-3-7(22-12(14,15)16)8(9(6)13)10(19)17-4-5-18/h2-3,5H,4H2,1H3,(H,17,19) |
| InChIKey | DNQKQJWOAPZWNK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.65 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|