C20H27N3O9S2 — CID 177044428
(2S,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[2-[2-[(4-isothiocyanatophenyl)carbamothioylamino]ethoxy]ethoxy]ethoxy]oxane-2-carboxylic acid (PubChem CID 177044428) has the molecular formula C20H27N3O9S2 and a molecular weight of 517.58 g/mol. Its IUPAC name is (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[2-[2-[(4-isothiocyanatophenyl)carbamothioylamino]ethoxy]ethoxy]ethoxy]oxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[2-[2-[(4-isothiocyanatophenyl)carbamothioylamino]ethoxy]ethoxy]ethoxy]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 177044428 |
| Molecular Formula | C20H27N3O9S2 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | (2S,3S,4S,5R)-3,4,5-trihydroxy-6-[2-[2-[2-[(4-isothiocyanatophenyl)carbamothioylamino]ethoxy]ethoxy]ethoxy]oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1OC(OCCOCCOCCNC(=S)Nc2ccc(N=C=S)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C20H27N3O9S2/c24-14-15(25)17(18(27)28)32-19(16(14)26)31-10-9-30-8-7-29-6-5-21-20(34)23-13-3-1-12(2-4-13)22-11-33/h1-4,14-17,19,24-26H,5-10H2,(H,27,28)(H2,21,23,34)/t14-,15-,16+,17-,19?/m0/s1 |
| InChIKey | HGCMBGCENUYGIC-OOHXRKOZSA-N |
| XLogP | -0.35 |
| TPSA | 171.33 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|