C35H56N4O2 — CID 177044457
tert-butyl (2E)-2-[[1,3-bis(2-propan-2-ylphenyl)-1,3-diazepan-2-ylidene]hydrazinylidene]acetate;propane (PubChem CID 177044457) has the molecular formula C35H56N4O2 and a molecular weight of 564.86 g/mol. Its IUPAC name is tert-butyl (2E)-2-[[1,3-bis(2-propan-2-ylphenyl)-1,3-diazepan-2-ylidene]hydrazinylidene]acetate;propane.
| Compound Name | tert-butyl (2E)-2-[[1,3-bis(2-propan-2-ylphenyl)-1,3-diazepan-2-ylidene]hydrazinylidene]acetate;propane |
|---|---|
| PubChem CID | 177044457 |
| Molecular Formula | C35H56N4O2 |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.44 |
| IUPAC Name | tert-butyl (2E)-2-[[1,3-bis(2-propan-2-ylphenyl)-1,3-diazepan-2-ylidene]hydrazinylidene]acetate;propane |
| SMILES | CC(C)c1ccccc1N1CCCCN(c2ccccc2C(C)C)C1=N/N=C/C(=O)OC(C)(C)C.CCC.CCC |
| InChI | InChI=1S/C29H40N4O2.2C3H8/c1-21(2)23-14-8-10-16-25(23)32-18-12-13-19-33(26-17-11-9-15-24(26)22(3)4)28(32)31-30-20-27(34)35-29(5,6)7;2*1-3-2/h8-11,14-17,20-22H,12-13,18-19H2,1-7H3;2*3H2,1-2H3/b30-20+;; |
| InChIKey | PYNAUCOTZDHDFL-ZEUJFDPDSA-N |
| XLogP | 9.56 |
| TPSA | 57.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|