C25H27N7O2 — CID 177044527
N-[5-(3,3,3-trideuteriopropanoyl)-4-[[(5R)-5,6,9-trimethyl-5H-pyrazino[2,3-c][1,7]naphthyridin-7-yl]amino]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 177044527) has the molecular formula C25H27N7O2 and a molecular weight of 460.56 g/mol. Its IUPAC name is N-[5-(3,3,3-trideuteriopropanoyl)-4-[[(5R)-5,6,9-trimethyl-5H-pyrazino[2,3-c][1,7]naphthyridin-7-yl]amino]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[5-(3,3,3-trideuteriopropanoyl)-4-[[(5R)-5,6,9-trimethyl-5H-pyrazino[2,3-c][1,7]naphthyridin-7-yl]amino]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 177044527 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N-[5-(3,3,3-trideuteriopropanoyl)-4-[[(5R)-5,6,9-trimethyl-5H-pyrazino[2,3-c][1,7]naphthyridin-7-yl]amino]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | [2H]C([2H])([2H])CC(=O)c1cnc(NC(=O)C2CC2)cc1Nc1nc(C)cc2c1N(C)[C@H](C)c1nccnc1-2 |
| InChI | InChI=1S/C25H27N7O2/c1-5-19(33)17-12-28-20(31-25(34)15-6-7-15)11-18(17)30-24-23-16(10-13(2)29-24)22-21(14(3)32(23)4)26-8-9-27-22/h8-12,14-15H,5-7H2,1-4H3,(H2,28,29,30,31,34)/t14-/m1/s1/i1D3 |
| InChIKey | QIEFZMMJJLVSSJ-XEVIKCSCSA-N |
| XLogP | 4.44 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |