C58H115NO4 — CID 177045189
(2S)-2-[di(nonyl)amino]-4-nonoxy-2,4-di(nonyl)-3-oxotridecanoic acid (PubChem CID 177045189) has the molecular formula C58H115NO4 and a molecular weight of 890.56 g/mol. Its IUPAC name is (2S)-2-[di(nonyl)amino]-4-nonoxy-2,4-di(nonyl)-3-oxotridecanoic acid.
| Compound Name | (2S)-2-[di(nonyl)amino]-4-nonoxy-2,4-di(nonyl)-3-oxotridecanoic acid |
|---|---|
| PubChem CID | 177045189 |
| Molecular Formula | C58H115NO4 |
| Molecular Weight | 890.56 g/mol |
| Exact Mass | 889.88 |
| IUPAC Name | (2S)-2-[di(nonyl)amino]-4-nonoxy-2,4-di(nonyl)-3-oxotridecanoic acid |
| SMILES | CCCCCCCCCOC(CCCCCCCCC)(CCCCCCCCC)C(=O)[C@@](CCCCCCCCC)(C(=O)O)N(CCCCCCCCC)CCCCCCCCC |
| InChI | InChI=1S/C58H115NO4/c1-7-13-19-25-31-37-43-49-57(50-44-38-32-26-20-14-8-2,63-54-48-42-36-30-24-18-12-6)55(60)58(56(61)62,51-45-39-33-27-21-15-9-3)59(52-46-40-34-28-22-16-10-4)53-47-41-35-29-23-17-11-5/h7-54H2,1-6H3,(H,61,62)/t58-/m0/s1 |
| InChIKey | AFJYTXPQXKBEJO-XKJQNMSGSA-N |
| XLogP | 19.11 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.56 |
| LogP ≤ 5 | 19.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|