C27H38N4O6S3 — CID 177045215
2-[[2-[2-[(2R)-2-[(E,3S)-3-hydroxy-8-(N-methylanilino)oct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carbonyl]amino]ethanesulfonic acid (PubChem CID 177045215) has the molecular formula C27H38N4O6S3 and a molecular weight of 610.82 g/mol. Its IUPAC name is 2-[[2-[2-[(2R)-2-[(E,3S)-3-hydroxy-8-(N-methylanilino)oct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carbonyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-[2-[(2R)-2-[(E,3S)-3-hydroxy-8-(N-methylanilino)oct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carbonyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 177045215 |
| Molecular Formula | C27H38N4O6S3 |
| Molecular Weight | 610.82 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 2-[[2-[2-[(2R)-2-[(E,3S)-3-hydroxy-8-(N-methylanilino)oct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carbonyl]amino]ethanesulfonic acid |
| SMILES | CN(CCCCC[C@H](O)/C=C/[C@H]1CCC(=O)N1CCSc1nc(C(=O)NCCS(=O)(=O)O)cs1)c1ccccc1 |
| InChI | InChI=1S/C27H38N4O6S3/c1-30(21-8-4-2-5-9-21)16-7-3-6-10-23(32)13-11-22-12-14-25(33)31(22)17-18-38-27-29-24(20-39-27)26(34)28-15-19-40(35,36)37/h2,4-5,8-9,11,13,20,22-23,32H,3,6-7,10,12,14-19H2,1H3,(H,28,34)(H,35,36,37)/b13-11+/t22-,23-/m0/s1 |
| InChIKey | KPTVLLXWHWRDAZ-FAKVZGHMSA-N |
| XLogP | 3.46 |
| TPSA | 140.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|