C36H31N3+2 — CID 177045461
N,N-bis[4-(1-methylpyridin-1-ium-4-yl)phenyl]-4-phenylaniline (PubChem CID 177045461) has the molecular formula C36H31N3+2 and a molecular weight of 505.67 g/mol. Its IUPAC name is N,N-bis[4-(1-methylpyridin-1-ium-4-yl)phenyl]-4-phenylaniline.
| Compound Name | N,N-bis[4-(1-methylpyridin-1-ium-4-yl)phenyl]-4-phenylaniline |
|---|---|
| PubChem CID | 177045461 |
| Molecular Formula | C36H31N3+2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | N,N-bis[4-(1-methylpyridin-1-ium-4-yl)phenyl]-4-phenylaniline |
| SMILES | C[n+]1ccc(-c2ccc(N(c3ccc(-c4ccccc4)cc3)c3ccc(-c4cc[n+](C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H31N3/c1-37-24-20-32(21-25-37)30-10-16-35(17-11-30)39(34-14-8-29(9-15-34)28-6-4-3-5-7-28)36-18-12-31(13-19-36)33-22-26-38(2)27-23-33/h3-27H,1-2H3/q+2 |
| InChIKey | WOBCXIUCTMXRDX-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 11.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|