C19H14BF7 — CID 177045543
bis(1,5-difluorocyclohexa-2,4-dien-1-yl)-(2,4,6-trifluoro-3-methylphenyl)borane (PubChem CID 177045543) has the molecular formula C19H14BF7 and a molecular weight of 386.12 g/mol. Its IUPAC name is bis(1,5-difluorocyclohexa-2,4-dien-1-yl)-(2,4,6-trifluoro-3-methylphenyl)borane.
| Compound Name | bis(1,5-difluorocyclohexa-2,4-dien-1-yl)-(2,4,6-trifluoro-3-methylphenyl)borane |
|---|---|
| PubChem CID | 177045543 |
| Molecular Formula | C19H14BF7 |
| Molecular Weight | 386.12 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | bis(1,5-difluorocyclohexa-2,4-dien-1-yl)-(2,4,6-trifluoro-3-methylphenyl)borane |
| SMILES | Cc1c(F)cc(F)c(B(C2(F)C=CC=C(F)C2)C2(F)C=CC=C(F)C2)c1F |
| InChI | InChI=1S/C19H14BF7/c1-11-14(23)8-15(24)16(17(11)25)20(18(26)6-2-4-12(21)9-18)19(27)7-3-5-13(22)10-19/h2-8H,9-10H2,1H3 |
| InChIKey | SEVKOJUEKASIIF-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.12 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|