About 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine
4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine (PubChem CID 177047131) has the molecular formula C16H14BrN3O2
and a molecular weight of 360.21 g/mol. Its IUPAC name is 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine |
| PubChem CID | 177047131 |
| Molecular Formula | C16H14BrN3O2 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine |
| SMILES | CNc1ccc2cccnc2n1.O=Cc1ccc(Br)c(O)c1 |
| InChI | InChI=1S/C9H9N3.C7H5BrO2/c1-10-8-5-4-7-3-2-6-11-9(7)12-8;8-6-2-1-5(4-9)3-7(6)10/h2-6H,1H3,(H,10,11,12);1-4,10H |
| InChIKey | OARIINVFOLVOQP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine?
The IUPAC name of 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine (CID 177047131) is 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine.
What is the SMILES notation for 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine?
The canonical SMILES for 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine is CNc1ccc2cccnc2n1.O=Cc1ccc(Br)c(O)c1.
What is the InChIKey of 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine?
The InChIKey is OARIINVFOLVOQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3.C7H5BrO2/c1-10-8-5-4-7-3-2-6-11-9(7)12-8;8-6-2-1-5(4-9)3-7(6)10/h2-6H,1H3,(H,10,11,12);1-4,10H.
What are the key properties of 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine?
4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine has a molecular weight of 360.21 g/mol, XLogP of 3.64, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-hydroxybenzaldehyde;N-methyl-1,8-naphthyridin-2-amine is sourced from PubChem (CID 177047131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).