C19H14F3N5OS — CID 177047281
[(Z)-[(Z)-4-amino-4-(3,4-difluoro-5-methylphenyl)-1-(1,8-naphthyridin-2-ylamino)-1-oxobut-3-en-2-ylidene]amino] thiohypofluorite (PubChem CID 177047281) has the molecular formula C19H14F3N5OS and a molecular weight of 417.42 g/mol. Its IUPAC name is [(Z)-[(Z)-4-amino-4-(3,4-difluoro-5-methylphenyl)-1-(1,8-naphthyridin-2-ylamino)-1-oxobut-3-en-2-ylidene]amino] thiohypofluorite.
| Compound Name | [(Z)-[(Z)-4-amino-4-(3,4-difluoro-5-methylphenyl)-1-(1,8-naphthyridin-2-ylamino)-1-oxobut-3-en-2-ylidene]amino] thiohypofluorite |
|---|---|
| PubChem CID | 177047281 |
| Molecular Formula | C19H14F3N5OS |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [(Z)-[(Z)-4-amino-4-(3,4-difluoro-5-methylphenyl)-1-(1,8-naphthyridin-2-ylamino)-1-oxobut-3-en-2-ylidene]amino] thiohypofluorite |
| SMILES | Cc1cc(/C(N)=C/C(=N/SF)C(=O)Nc2ccc3cccnc3n2)cc(F)c1F |
| InChI | InChI=1S/C19H14F3N5OS/c1-10-7-12(8-13(20)17(10)21)14(23)9-15(27-29-22)19(28)26-16-5-4-11-3-2-6-24-18(11)25-16/h2-9H,23H2,1H3,(H,24,25,26,28)/b14-9-,27-15- |
| InChIKey | YLCVGXLZURVLCY-SZFAPYCOSA-N |
| XLogP | 4.13 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|