C21H24N4 — CID 177047334
(3E,4Z)-2-N-[(E)-3-[[5-[(1Z)-buta-1,3-dienyl]-2,3-dihydropyridin-6-yl]imino]prop-1-enyl]-3-ethylidenehepta-4,6-diene-1,2-diimine (PubChem CID 177047334) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is (3E,4Z)-2-N-[(E)-3-[[5-[(1Z)-buta-1,3-dienyl]-2,3-dihydropyridin-6-yl]imino]prop-1-enyl]-3-ethylidenehepta-4,6-diene-1,2-diimine.
| Compound Name | (3E,4Z)-2-N-[(E)-3-[[5-[(1Z)-buta-1,3-dienyl]-2,3-dihydropyridin-6-yl]imino]prop-1-enyl]-3-ethylidenehepta-4,6-diene-1,2-diimine |
|---|---|
| PubChem CID | 177047334 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (3E,4Z)-2-N-[(E)-3-[[5-[(1Z)-buta-1,3-dienyl]-2,3-dihydropyridin-6-yl]imino]prop-1-enyl]-3-ethylidenehepta-4,6-diene-1,2-diimine |
| SMILES | [H]/N=C/C(=N/C=C/C=N/C1=NCCC=C1/C=C\C=C)C(/C=C\C=C)=C/C |
| InChI | InChI=1S/C21H24N4/c1-4-7-11-18(6-3)20(17-22)23-15-10-16-25-21-19(12-8-5-2)13-9-14-24-21/h4-8,10-13,15-17,22H,1-2,9,14H2,3H3/b11-7-,12-8-,15-10+,18-6+,22-17+,23-20+,25-16+ |
| InChIKey | AKKWLHCXNBTLGS-DQCBBDFASA-N |
| XLogP | 4.82 |
| TPSA | 60.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|