C17H15Cl2FN6S2 — CID 177049125
(1-cyanocyclopropanecarboximidoyl) 1,8-dichloro-6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanylimidazo[1,5-a]pyridine-3-carboximidothioate (PubChem CID 177049125) has the molecular formula C17H15Cl2FN6S2 and a molecular weight of 457.39 g/mol. Its IUPAC name is (1-cyanocyclopropanecarboximidoyl) 1,8-dichloro-6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanylimidazo[1,5-a]pyridine-3-carboximidothioate.
| Compound Name | (1-cyanocyclopropanecarboximidoyl) 1,8-dichloro-6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanylimidazo[1,5-a]pyridine-3-carboximidothioate |
|---|---|
| PubChem CID | 177049125 |
| Molecular Formula | C17H15Cl2FN6S2 |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | (1-cyanocyclopropanecarboximidoyl) 1,8-dichloro-6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanylimidazo[1,5-a]pyridine-3-carboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])C1(C#N)CC1)c1nc(Cl)c2c(Cl)cc(SNC3(CF)CC3)cn12 |
| InChI | InChI=1S/C17H15Cl2FN6S2/c18-10-5-9(28-25-17(7-20)3-4-17)6-26-11(10)12(19)24-14(26)13(22)27-15(23)16(8-21)1-2-16/h5-6,22-23,25H,1-4,7H2/b22-13-,23-15+ |
| InChIKey | TURVUYOALMFNFZ-QHVGNZBQSA-N |
| XLogP | 5.08 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|