C23H26FN7S2 — CID 177049268
(1-cyanocyclopropanecarboximidoyl) 8-(3-azabicyclo[4.1.0]heptan-6-yl)-6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanylimidazo[1,5-a]pyridine-3-carboximidothioate (PubChem CID 177049268) has the molecular formula C23H26FN7S2 and a molecular weight of 483.64 g/mol. Its IUPAC name is (1-cyanocyclopropanecarboximidoyl) 8-(3-azabicyclo[4.1.0]heptan-6-yl)-6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanylimidazo[1,5-a]pyridine-3-carboximidothioate.
| Compound Name | (1-cyanocyclopropanecarboximidoyl) 8-(3-azabicyclo[4.1.0]heptan-6-yl)-6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanylimidazo[1,5-a]pyridine-3-carboximidothioate |
|---|---|
| PubChem CID | 177049268 |
| Molecular Formula | C23H26FN7S2 |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | (1-cyanocyclopropanecarboximidoyl) 8-(3-azabicyclo[4.1.0]heptan-6-yl)-6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanylimidazo[1,5-a]pyridine-3-carboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])C1(C#N)CC1)c1ncc2c(C34CCNCC3C4)cc(SNC3(CF)CC3)cn12 |
| InChI | InChI=1S/C23H26FN7S2/c24-12-22(3-4-22)30-33-15-7-16(23-5-6-28-9-14(23)8-23)17-10-29-19(31(17)11-15)18(26)32-20(27)21(13-25)1-2-21/h7,10-11,14,26-28,30H,1-6,8-9,12H2/b26-18-,27-20+ |
| InChIKey | SUFNVBCIGWXKHL-ICNIPSTASA-N |
| XLogP | 4.02 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|