C27H36FN7OS2 — CID 177049430
(1-cyanocyclopropanecarboximidoyl) 6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanyl-8-(1-methylpiperidin-4-yl)imidazo[1,5-a]pyridine-3-carboximidothioate;2-methylpropanal (PubChem CID 177049430) has the molecular formula C27H36FN7OS2 and a molecular weight of 557.77 g/mol. Its IUPAC name is (1-cyanocyclopropanecarboximidoyl) 6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanyl-8-(1-methylpiperidin-4-yl)imidazo[1,5-a]pyridine-3-carboximidothioate;2-methylpropanal.
| Compound Name | (1-cyanocyclopropanecarboximidoyl) 6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanyl-8-(1-methylpiperidin-4-yl)imidazo[1,5-a]pyridine-3-carboximidothioate;2-methylpropanal |
|---|---|
| PubChem CID | 177049430 |
| Molecular Formula | C27H36FN7OS2 |
| Molecular Weight | 557.77 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | (1-cyanocyclopropanecarboximidoyl) 6-[[1-(fluoromethyl)cyclopropyl]amino]sulfanyl-8-(1-methylpiperidin-4-yl)imidazo[1,5-a]pyridine-3-carboximidothioate;2-methylpropanal |
| SMILES | CC(C)C=O.[H]/N=C(\S/C(=N/[H])C1(C#N)CC1)c1ncc2c(C3CCN(C)CC3)cc(SNC3(CF)CC3)cn12 |
| InChI | InChI=1S/C23H28FN7S2.C4H8O/c1-30-8-2-15(3-9-30)17-10-16(33-29-23(13-24)6-7-23)12-31-18(17)11-28-20(31)19(26)32-21(27)22(14-25)4-5-22;1-4(2)3-5/h10-12,15,26-27,29H,2-9,13H2,1H3;3-4H,1-2H3/b26-19-,27-21+; |
| InChIKey | IYOOYWAUHBJIBR-SQECGVHCSA-N |
| XLogP | 5.42 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.77 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|