About 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile
1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile (PubChem CID 177049682) has the molecular formula C7H6BrN3S
and a molecular weight of 244.12 g/mol. Its IUPAC name is 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile |
| PubChem CID | 177049682 |
| Molecular Formula | C7H6BrN3S |
| Molecular Weight | 244.12 g/mol |
| Exact Mass | 242.95 |
| IUPAC Name | 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile |
| SMILES | N#CC1(c2nnc(Br)s2)CCC1 |
| InChI | InChI=1S/C7H6BrN3S/c8-6-11-10-5(12-6)7(4-9)2-1-3-7/h1-3H2 |
| InChIKey | MZCWILGWESSMAT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.12 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile?
The IUPAC name of 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile (CID 177049682) is 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile.
What is the SMILES notation for 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile?
The canonical SMILES for 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile is N#CC1(c2nnc(Br)s2)CCC1.
What is the InChIKey of 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile?
The InChIKey is MZCWILGWESSMAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrN3S/c8-6-11-10-5(12-6)7(4-9)2-1-3-7/h1-3H2.
What are the key properties of 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile?
1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile has a molecular weight of 244.12 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-1,3,4-thiadiazol-2-yl)cyclobutane-1-carbonitrile is sourced from PubChem (CID 177049682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).