C20H18F4N6O2 — CID 177049839
N-[(4S)-2-(2-cyclopropyl-5-fluoro-4-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzoxazol-4-yl]-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxamide (PubChem CID 177049839) has the molecular formula C20H18F4N6O2 and a molecular weight of 450.40 g/mol. Its IUPAC name is N-[(4S)-2-(2-cyclopropyl-5-fluoro-4-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzoxazol-4-yl]-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[(4S)-2-(2-cyclopropyl-5-fluoro-4-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzoxazol-4-yl]-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 177049839 |
| Molecular Formula | C20H18F4N6O2 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-[(4S)-2-(2-cyclopropyl-5-fluoro-4-pyridinyl)-4,5,6,7-tetrahydro-1,3-benzoxazol-4-yl]-2-methyl-5-(trifluoromethyl)-1,2,4-triazole-3-carboxamide |
| SMILES | Cn1nc(C(F)(F)F)nc1C(=O)N[C@H]1CCCc2oc(-c3cc(C4CC4)ncc3F)nc21 |
| InChI | InChI=1S/C20H18F4N6O2/c1-30-16(28-19(29-30)20(22,23)24)17(31)26-12-3-2-4-14-15(12)27-18(32-14)10-7-13(9-5-6-9)25-8-11(10)21/h7-9,12H,2-6H2,1H3,(H,26,31)/t12-/m0/s1 |
| InChIKey | TWBSIBDDTVJFPA-LBPRGKRZSA-N |
| XLogP | 3.71 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |