C14H12F3N5O — CID 177050071
4-azido-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]oxazole (PubChem CID 177050071) has the molecular formula C14H12F3N5O and a molecular weight of 323.28 g/mol. Its IUPAC name is 4-azido-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]oxazole.
| Compound Name | 4-azido-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]oxazole |
|---|---|
| PubChem CID | 177050071 |
| Molecular Formula | C14H12F3N5O |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 4-azido-2-[2-(trifluoromethyl)-4-pyridinyl]-5,6,7,8-tetrahydro-4H-cyclohepta[d][1,3]oxazole |
| SMILES | [N-]=[N+]=NC1CCCCc2oc(-c3ccnc(C(F)(F)F)c3)nc21 |
| InChI | InChI=1S/C14H12F3N5O/c15-14(16,17)11-7-8(5-6-19-11)13-20-12-9(21-22-18)3-1-2-4-10(12)23-13/h5-7,9H,1-4H2 |
| InChIKey | RCNWBQRMNURTNA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 87.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|