About potassium;carbanide;1-chloro-3-methylbenzene-4-ide
potassium;carbanide;1-chloro-3-methylbenzene-4-ide (PubChem CID 177050107) has the molecular formula C8H9ClK-
and a molecular weight of 179.71 g/mol. Its IUPAC name is potassium;carbanide;1-chloro-3-methylbenzene-4-ide.
Molecular Properties
| Compound Name | potassium;carbanide;1-chloro-3-methylbenzene-4-ide |
| PubChem CID | 177050107 |
| Molecular Formula | C8H9ClK- |
| Molecular Weight | 179.71 g/mol |
| Exact Mass | 179.00 |
| IUPAC Name | potassium;carbanide;1-chloro-3-methylbenzene-4-ide |
| SMILES | Cc1[c-]ccc(Cl)c1.[CH3-].[K+] |
| InChI | InChI=1S/C7H6Cl.CH3.K/c1-6-3-2-4-7(8)5-6;;/h2,4-5H,1H3;1H3;/q2*-1;+1 |
| InChIKey | YWDBBGHAXKOABF-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.71 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;carbanide;1-chloro-3-methylbenzene-4-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbanide;1-chloro-3-methylbenzene-4-ide?
The IUPAC name of potassium;carbanide;1-chloro-3-methylbenzene-4-ide (CID 177050107) is potassium;carbanide;1-chloro-3-methylbenzene-4-ide.
What is the SMILES notation for potassium;carbanide;1-chloro-3-methylbenzene-4-ide?
The canonical SMILES for potassium;carbanide;1-chloro-3-methylbenzene-4-ide is Cc1[c-]ccc(Cl)c1.[CH3-].[K+].
What is the InChIKey of potassium;carbanide;1-chloro-3-methylbenzene-4-ide?
The InChIKey is YWDBBGHAXKOABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl.CH3.K/c1-6-3-2-4-7(8)5-6;;/h2,4-5H,1H3;1H3;/q2*-1;+1.
What are the key properties of potassium;carbanide;1-chloro-3-methylbenzene-4-ide?
potassium;carbanide;1-chloro-3-methylbenzene-4-ide has a molecular weight of 179.71 g/mol, XLogP of -0.10, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbanide;1-chloro-3-methylbenzene-4-ide is sourced from PubChem (CID 177050107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).