About 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one
2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one (PubChem CID 177050871) has the molecular formula C12H8F3N3O
and a molecular weight of 267.21 g/mol. Its IUPAC name is 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one.
Molecular Properties
| Compound Name | 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one |
| PubChem CID | 177050871 |
| Molecular Formula | C12H8F3N3O |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one |
| SMILES | O=C1CCn2nc(-c3ccnc(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C12H8F3N3O/c13-12(14,15)11-5-7(1-3-16-11)8-6-9-10(19)2-4-18(9)17-8/h1,3,5-6H,2,4H2 |
| InChIKey | YXVPAIVNRDULCW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one?
The IUPAC name of 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one (CID 177050871) is 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one.
What is the SMILES notation for 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one?
The canonical SMILES for 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one is O=C1CCn2nc(-c3ccnc(C(F)(F)F)c3)cc21.
What is the InChIKey of 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one?
The InChIKey is YXVPAIVNRDULCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3N3O/c13-12(14,15)11-5-7(1-3-16-11)8-6-9-10(19)2-4-18(9)17-8/h1,3,5-6H,2,4H2.
What are the key properties of 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one?
2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one has a molecular weight of 267.21 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydropyrrolo[2,1-e]pyrazol-4-one is sourced from PubChem (CID 177050871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).