About 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole
2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (PubChem CID 177051296) has the molecular formula C12H9ClF3N3
and a molecular weight of 287.67 g/mol. Its IUPAC name is 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
Molecular Properties
| Compound Name | 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| PubChem CID | 177051296 |
| Molecular Formula | C12H9ClF3N3 |
| Molecular Weight | 287.67 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole |
| SMILES | FC(F)(F)c1cc(-c2cc3n(n2)CCC3)c(Cl)cn1 |
| InChI | InChI=1S/C12H9ClF3N3/c13-9-6-17-11(12(14,15)16)5-8(9)10-4-7-2-1-3-19(7)18-10/h4-6H,1-3H2 |
| InChIKey | QAEZGIDBRKVXGN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.67 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The IUPAC name of 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole (CID 177051296) is 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole.
What is the SMILES notation for 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The canonical SMILES for 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is FC(F)(F)c1cc(-c2cc3n(n2)CCC3)c(Cl)cn1.
What is the InChIKey of 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
The InChIKey is QAEZGIDBRKVXGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9ClF3N3/c13-9-6-17-11(12(14,15)16)5-8(9)10-4-7-2-1-3-19(7)18-10/h4-6H,1-3H2.
What are the key properties of 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole?
2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole has a molecular weight of 287.67 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-chloro-2-(trifluoromethyl)-4-pyridinyl]-5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole is sourced from PubChem (CID 177051296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).