C19H15F6N5OS — CID 177051543
2-methyl-4-(trifluoromethyl)-N-[2-[2-(trifluoromethyl)-4-pyridinyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-yl]-1,3-thiazole-5-carboxamide (PubChem CID 177051543) has the molecular formula C19H15F6N5OS and a molecular weight of 475.42 g/mol. Its IUPAC name is 2-methyl-4-(trifluoromethyl)-N-[2-[2-(trifluoromethyl)-4-pyridinyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-yl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-methyl-4-(trifluoromethyl)-N-[2-[2-(trifluoromethyl)-4-pyridinyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-yl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 177051543 |
| Molecular Formula | C19H15F6N5OS |
| Molecular Weight | 475.42 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 2-methyl-4-(trifluoromethyl)-N-[2-[2-(trifluoromethyl)-4-pyridinyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridin-4-yl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(F)(F)F)c(C(=O)NC2CCCn3nc(-c4ccnc(C(F)(F)F)c4)cc32)s1 |
| InChI | InChI=1S/C19H15F6N5OS/c1-9-27-16(19(23,24)25)15(32-9)17(31)28-11-3-2-6-30-13(11)8-12(29-30)10-4-5-26-14(7-10)18(20,21)22/h4-5,7-8,11H,2-3,6H2,1H3,(H,28,31) |
| InChIKey | KQSYOUZIDPVEGG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |