C17H18F3N5S — CID 177051884
1-methyl-N-[2-[methyl-[4-(trifluoromethyl)-2-pyridinyl]amino]ethylsulfanyl]indazol-7-amine (PubChem CID 177051884) has the molecular formula C17H18F3N5S and a molecular weight of 381.43 g/mol. Its IUPAC name is 1-methyl-N-[2-[methyl-[4-(trifluoromethyl)-2-pyridinyl]amino]ethylsulfanyl]indazol-7-amine.
| Compound Name | 1-methyl-N-[2-[methyl-[4-(trifluoromethyl)-2-pyridinyl]amino]ethylsulfanyl]indazol-7-amine |
|---|---|
| PubChem CID | 177051884 |
| Molecular Formula | C17H18F3N5S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-methyl-N-[2-[methyl-[4-(trifluoromethyl)-2-pyridinyl]amino]ethylsulfanyl]indazol-7-amine |
| SMILES | CN(CCSNc1cccc2cnn(C)c12)c1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C17H18F3N5S/c1-24(15-10-13(6-7-21-15)17(18,19)20)8-9-26-23-14-5-3-4-12-11-22-25(2)16(12)14/h3-7,10-11,23H,8-9H2,1-2H3 |
| InChIKey | NTWWEKNSFSDWHZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|