C22H33N5O6 — CID 177052102
3-[3-[2-[2-[2-[[(2E)-3-(2-aminoethoxy)-2-hydrazinylidenepropylidene]amino]ethoxy]ethoxy]ethoxy]phenyl]piperidine-2,6-dione (PubChem CID 177052102) has the molecular formula C22H33N5O6 and a molecular weight of 463.54 g/mol. Its IUPAC name is 3-[3-[2-[2-[2-[[(2E)-3-(2-aminoethoxy)-2-hydrazinylidenepropylidene]amino]ethoxy]ethoxy]ethoxy]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[3-[2-[2-[2-[[(2E)-3-(2-aminoethoxy)-2-hydrazinylidenepropylidene]amino]ethoxy]ethoxy]ethoxy]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 177052102 |
| Molecular Formula | C22H33N5O6 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 3-[3-[2-[2-[2-[[(2E)-3-(2-aminoethoxy)-2-hydrazinylidenepropylidene]amino]ethoxy]ethoxy]ethoxy]phenyl]piperidine-2,6-dione |
| SMILES | NCCOCC(/C=N/CCOCCOCCOc1cccc(C2CCC(=O)NC2=O)c1)=N/N |
| InChI | InChI=1S/C22H33N5O6/c23-6-8-32-16-18(27-24)15-25-7-9-30-10-11-31-12-13-33-19-3-1-2-17(14-19)20-4-5-21(28)26-22(20)29/h1-3,14-15,20H,4-13,16,23-24H2,(H,26,28,29)/b25-15+,27-18+ |
| InChIKey | MTQYORSUOOMMOH-ROBUNQHXSA-N |
| XLogP | -0.02 |
| TPSA | 159.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|