C13H22F3N4Y- — CID 177052633
carbanide;(1Z,3E)-2-(2,2-dimethylpropyliminomethyl)-5,5,5-trifluoro-4-methanimidoylpenta-1,3-diene-1,3-diamine;yttrium (PubChem CID 177052633) has the molecular formula C13H22F3N4Y- and a molecular weight of 380.25 g/mol. Its IUPAC name is carbanide;(1Z,3E)-2-(2,2-dimethylpropyliminomethyl)-5,5,5-trifluoro-4-methanimidoylpenta-1,3-diene-1,3-diamine;yttrium.
| Compound Name | carbanide;(1Z,3E)-2-(2,2-dimethylpropyliminomethyl)-5,5,5-trifluoro-4-methanimidoylpenta-1,3-diene-1,3-diamine;yttrium |
|---|---|
| PubChem CID | 177052633 |
| Molecular Formula | C13H22F3N4Y- |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | carbanide;(1Z,3E)-2-(2,2-dimethylpropyliminomethyl)-5,5,5-trifluoro-4-methanimidoylpenta-1,3-diene-1,3-diamine;yttrium |
| SMILES | [CH3-].[H]/N=C/C(=C(N)/C(=C/N)/C=N/CC(C)(C)C)C(F)(F)F.[Y] |
| InChI | InChI=1S/C12H19F3N4.CH3.Y/c1-11(2,3)7-19-6-8(4-16)10(18)9(5-17)12(13,14)15;;/h4-6,17H,7,16,18H2,1-3H3;1H3;/q;-1;/b8-4+,10-9+,17-5+,19-6+;; |
| InChIKey | ACVACTNWLOVQQD-KVWBAGCUSA-N |
| XLogP | 2.82 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|