About 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane
3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane (PubChem CID 177052728) has the molecular formula C22H33N3O2
and a molecular weight of 371.53 g/mol. Its IUPAC name is 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane.
Molecular Properties
| Compound Name | 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane |
| PubChem CID | 177052728 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane |
| SMILES | CC.O=C1CCC(c2ccc(N3CCC4(CCNCC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C20H27N3O2.C2H6/c24-18-6-5-17(19(25)22-18)15-1-3-16(4-2-15)23-13-9-20(10-14-23)7-11-21-12-8-20;1-2/h1-4,17,21H,5-14H2,(H,22,24,25);1-2H3 |
| InChIKey | FGWDJKADTZVDHU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane?
The IUPAC name of 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane (CID 177052728) is 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane.
What is the SMILES notation for 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane?
The canonical SMILES for 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane is CC.O=C1CCC(c2ccc(N3CCC4(CCNCC4)CC3)cc2)C(=O)N1.
What is the InChIKey of 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane?
The InChIKey is FGWDJKADTZVDHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N3O2.C2H6/c24-18-6-5-17(19(25)22-18)15-1-3-16(4-2-15)23-13-9-20(10-14-23)7-11-21-12-8-20;1-2/h1-4,17,21H,5-14H2,(H,22,24,25);1-2H3.
What are the key properties of 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane?
3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane has a molecular weight of 371.53 g/mol, XLogP of 3.20, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3,9-diazaspiro[5.5]undecan-3-yl)phenyl]piperidine-2,6-dione;ethane is sourced from PubChem (CID 177052728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).