C18H20F4N6OS — CID 177052768
1-[[(E)-3-amino-2-[2-(4-aminosulfanyl-2-fluoroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]prop-2-enylidene]amino]-2-methylpropan-2-ol (PubChem CID 177052768) has the molecular formula C18H20F4N6OS and a molecular weight of 444.46 g/mol. Its IUPAC name is 1-[[(E)-3-amino-2-[2-(4-aminosulfanyl-2-fluoroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]prop-2-enylidene]amino]-2-methylpropan-2-ol.
| Compound Name | 1-[[(E)-3-amino-2-[2-(4-aminosulfanyl-2-fluoroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]prop-2-enylidene]amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 177052768 |
| Molecular Formula | C18H20F4N6OS |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 1-[[(E)-3-amino-2-[2-(4-aminosulfanyl-2-fluoroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]prop-2-enylidene]amino]-2-methylpropan-2-ol |
| SMILES | CC(C)(O)C/N=C/C(=C\N)c1nc(Nc2ccc(SN)cc2F)ncc1C(F)(F)F |
| InChI | InChI=1S/C18H20F4N6OS/c1-17(2,29)9-25-7-10(6-23)15-12(18(20,21)22)8-26-16(28-15)27-14-4-3-11(30-24)5-13(14)19/h3-8,29H,9,23-24H2,1-2H3,(H,26,27,28)/b10-6+,25-7+ |
| InChIKey | LTVGNVZPNBBKQK-ZAGBDARISA-N |
| XLogP | 3.49 |
| TPSA | 122.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|