About 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane
2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane (PubChem CID 177052977) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane.
Molecular Properties
| Compound Name | 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane |
| PubChem CID | 177052977 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane |
| SMILES | C=C/C=C\C1=C(C)CN(C(CCC=O)C(=O)NC)C1=O.CC |
| InChI | InChI=1S/C15H20N2O3.C2H6/c1-4-5-7-12-11(2)10-17(15(12)20)13(8-6-9-18)14(19)16-3;1-2/h4-5,7,9,13H,1,6,8,10H2,2-3H3,(H,16,19);1-2H3/b7-5-; |
| InChIKey | KOPHUVXOMOAFRH-YJOCEBFMSA-N |
| XLogP | 2.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane?
The IUPAC name of 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane (CID 177052977) is 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane.
What is the SMILES notation for 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane?
The canonical SMILES for 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane is C=C/C=C\C1=C(C)CN(C(CCC=O)C(=O)NC)C1=O.CC.
What is the InChIKey of 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane?
The InChIKey is KOPHUVXOMOAFRH-YJOCEBFMSA-N. The full InChI is InChI=1S/C15H20N2O3.C2H6/c1-4-5-7-12-11(2)10-17(15(12)20)13(8-6-9-18)14(19)16-3;1-2/h4-5,7,9,13H,1,6,8,10H2,2-3H3,(H,16,19);1-2H3/b7-5-;.
What are the key properties of 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane?
2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane has a molecular weight of 306.41 g/mol, XLogP of 2.01, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(1Z)-buta-1,3-dienyl]-3-methyl-5-oxo-2H-pyrrol-1-yl]-N-methyl-5-oxopentanamide;ethane is sourced from PubChem (CID 177052977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).