About 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine
8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine (PubChem CID 177053181) has the molecular formula C17H16N2O2S
and a molecular weight of 312.39 g/mol. Its IUPAC name is 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine.
Molecular Properties
| Compound Name | 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine |
| PubChem CID | 177053181 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine |
| SMILES | COc1nccc2c(OCc3ccc(SC)cc3)ccnc12 |
| InChI | InChI=1S/C17H16N2O2S/c1-20-17-16-14(7-9-19-17)15(8-10-18-16)21-11-12-3-5-13(22-2)6-4-12/h3-10H,11H2,1-2H3 |
| InChIKey | VKDBTJDGCHSDDF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine?
The IUPAC name of 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine (CID 177053181) is 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine.
What is the SMILES notation for 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine?
The canonical SMILES for 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine is COc1nccc2c(OCc3ccc(SC)cc3)ccnc12.
What is the InChIKey of 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine?
The InChIKey is VKDBTJDGCHSDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O2S/c1-20-17-16-14(7-9-19-17)15(8-10-18-16)21-11-12-3-5-13(22-2)6-4-12/h3-10H,11H2,1-2H3.
What are the key properties of 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine?
8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine has a molecular weight of 312.39 g/mol, XLogP of 3.94, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-4-[(4-methylsulfanylphenyl)methoxy]-1,7-naphthyridine is sourced from PubChem (CID 177053181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).