About ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone
ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone (PubChem CID 177053586) has the molecular formula C16H31NO
and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone.
Molecular Properties
| Compound Name | ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone |
| PubChem CID | 177053586 |
| Molecular Formula | C16H31NO |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.24 |
| IUPAC Name | ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone |
| SMILES | CC.CC(=O)C1=CC=NC1C.CCCC(C)CC |
| InChI | InChI=1S/C7H9NO.C7H16.C2H6/c1-5-7(6(2)9)3-4-8-5;1-4-6-7(3)5-2;1-2/h3-5H,1-2H3;7H,4-6H2,1-3H3;1-2H3 |
| InChIKey | QDPPKNUMQAJLKK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone?
The IUPAC name of ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone (CID 177053586) is ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone.
What is the SMILES notation for ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone?
The canonical SMILES for ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone is CC.CC(=O)C1=CC=NC1C.CCCC(C)CC.
What is the InChIKey of ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone?
The InChIKey is QDPPKNUMQAJLKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.C7H16.C2H6/c1-5-7(6(2)9)3-4-8-5;1-4-6-7(3)5-2;1-2/h3-5H,1-2H3;7H,4-6H2,1-3H3;1-2H3.
What are the key properties of ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone?
ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone has a molecular weight of 253.43 g/mol, XLogP of 4.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylhexane;1-(2-methyl-2H-pyrrol-3-yl)ethanone is sourced from PubChem (CID 177053586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).