About 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine
3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 177053588) has the molecular formula C9H10FN
and a molecular weight of 151.18 g/mol. Its IUPAC name is 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
Molecular Properties
| Compound Name | 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| PubChem CID | 177053588 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | CC1Cc2cc(F)cnc2C1 |
| InChI | InChI=1S/C9H10FN/c1-6-2-7-4-8(10)5-11-9(7)3-6/h4-6H,2-3H2,1H3 |
| InChIKey | RZZBEBQYEJISQP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The IUPAC name of 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine (CID 177053588) is 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
What is the SMILES notation for 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The canonical SMILES for 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine is CC1Cc2cc(F)cnc2C1.
What is the InChIKey of 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
The InChIKey is RZZBEBQYEJISQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FN/c1-6-2-7-4-8(10)5-11-9(7)3-6/h4-6H,2-3H2,1H3.
What are the key properties of 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine?
3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine has a molecular weight of 151.18 g/mol, XLogP of 1.96, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine is sourced from PubChem (CID 177053588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).