C14H26N2 — CID 177053620
ethane;5-methyl-2-(3-methylpyrrolidin-1-yl)hexa-1,4-dien-3-imine (PubChem CID 177053620) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;5-methyl-2-(3-methylpyrrolidin-1-yl)hexa-1,4-dien-3-imine.
| Compound Name | ethane;5-methyl-2-(3-methylpyrrolidin-1-yl)hexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 177053620 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;5-methyl-2-(3-methylpyrrolidin-1-yl)hexa-1,4-dien-3-imine |
| SMILES | CC.[H]/N=C(\C=C(C)C)C(=C)N1CCC(C)C1 |
| InChI | InChI=1S/C12H20N2.C2H6/c1-9(2)7-12(13)11(4)14-6-5-10(3)8-14;1-2/h7,10,13H,4-6,8H2,1-3H3;1-2H3/b13-12+; |
| InChIKey | GJMYWICYNUXEOD-UEIGIMKUSA-N |
| XLogP | 3.85 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|