About (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine
(Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine (PubChem CID 177053750) has the molecular formula C12H24FN
and a molecular weight of 201.33 g/mol. Its IUPAC name is (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine.
Molecular Properties
| Compound Name | (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine |
| PubChem CID | 177053750 |
| Molecular Formula | C12H24FN |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine |
| SMILES | CCC(C)C(C/C=C(/C)F)N(C)CC |
| InChI | InChI=1S/C12H24FN/c1-6-10(3)12(14(5)7-2)9-8-11(4)13/h8,10,12H,6-7,9H2,1-5H3/b11-8- |
| InChIKey | BWPVCIALBACPAF-FLIBITNWSA-N |
| XLogP | 3.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine?
The IUPAC name of (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine (CID 177053750) is (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine.
What is the SMILES notation for (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine?
The canonical SMILES for (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine is CCC(C)C(C/C=C(/C)F)N(C)CC.
What is the InChIKey of (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine?
The InChIKey is BWPVCIALBACPAF-FLIBITNWSA-N. The full InChI is InChI=1S/C12H24FN/c1-6-10(3)12(14(5)7-2)9-8-11(4)13/h8,10,12H,6-7,9H2,1-5H3/b11-8-.
What are the key properties of (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine?
(Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine has a molecular weight of 201.33 g/mol, XLogP of 3.62, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N-ethyl-7-fluoro-N,3-dimethyloct-6-en-4-amine is sourced from PubChem (CID 177053750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).