About methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate
methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate (PubChem CID 177053844) has the molecular formula C10H10BrNO2
and a molecular weight of 256.10 g/mol. Its IUPAC name is methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate |
| PubChem CID | 177053844 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate |
| SMILES | COC(=O)C1Cc2cc(Br)cnc2C1 |
| InChI | InChI=1S/C10H10BrNO2/c1-14-10(13)7-2-6-3-8(11)5-12-9(6)4-7/h3,5,7H,2,4H2,1H3 |
| InChIKey | VFEPEYQPRVFJSW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate?
The IUPAC name of methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate (CID 177053844) is methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate.
What is the SMILES notation for methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate?
The canonical SMILES for methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate is COC(=O)C1Cc2cc(Br)cnc2C1.
What is the InChIKey of methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate?
The InChIKey is VFEPEYQPRVFJSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNO2/c1-14-10(13)7-2-6-3-8(11)5-12-9(6)4-7/h3,5,7H,2,4H2,1H3.
What are the key properties of methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate?
methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate has a molecular weight of 256.10 g/mol, XLogP of 1.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-bromo-6,7-dihydro-5H-cyclopenta[b]pyridine-6-carboxylate is sourced from PubChem (CID 177053844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).