About 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine
1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine (PubChem CID 177053855) has the molecular formula C11H23F2N
and a molecular weight of 207.31 g/mol. Its IUPAC name is 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine.
Molecular Properties
| Compound Name | 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine |
| PubChem CID | 177053855 |
| Molecular Formula | C11H23F2N |
| Molecular Weight | 207.31 g/mol |
| Exact Mass | 207.18 |
| IUPAC Name | 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine |
| SMILES | C=C(C)CCN(C)CCC.FCCF |
| InChI | InChI=1S/C9H19N.C2H4F2/c1-5-7-10(4)8-6-9(2)3;3-1-2-4/h2,5-8H2,1,3-4H3;1-2H2 |
| InChIKey | GQZLJWXSEQGFSA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine?
The IUPAC name of 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine (CID 177053855) is 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine.
What is the SMILES notation for 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine?
The canonical SMILES for 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine is C=C(C)CCN(C)CCC.FCCF.
What is the InChIKey of 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine?
The InChIKey is GQZLJWXSEQGFSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C2H4F2/c1-5-7-10(4)8-6-9(2)3;3-1-2-4/h2,5-8H2,1,3-4H3;1-2H2.
What are the key properties of 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine?
1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine has a molecular weight of 207.31 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-difluoroethane;N,3-dimethyl-N-propylbut-3-en-1-amine is sourced from PubChem (CID 177053855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).