About 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane
2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane (PubChem CID 177053875) has the molecular formula C19H43N
and a molecular weight of 285.56 g/mol. Its IUPAC name is 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane.
Molecular Properties
| Compound Name | 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane |
| PubChem CID | 177053875 |
| Molecular Formula | C19H43N |
| Molecular Weight | 285.56 g/mol |
| Exact Mass | 285.34 |
| IUPAC Name | 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane |
| SMILES | C=C(C)N1CC(C)CC1C.CC.CC.CCC(C)CC |
| InChI | InChI=1S/C9H17N.C6H14.2C2H6/c1-7(2)10-6-8(3)5-9(10)4;1-4-6(3)5-2;2*1-2/h8-9H,1,5-6H2,2-4H3;6H,4-5H2,1-3H3;2*1-2H3 |
| InChIKey | RJKAFWAPDMOREK-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane?
The IUPAC name of 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane (CID 177053875) is 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane.
What is the SMILES notation for 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane?
The canonical SMILES for 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane is C=C(C)N1CC(C)CC1C.CC.CC.CCC(C)CC.
What is the InChIKey of 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane?
The InChIKey is RJKAFWAPDMOREK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.C6H14.2C2H6/c1-7(2)10-6-8(3)5-9(10)4;1-4-6(3)5-2;2*1-2/h8-9H,1,5-6H2,2-4H3;6H,4-5H2,1-3H3;2*1-2H3.
What are the key properties of 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane?
2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane has a molecular weight of 285.56 g/mol, XLogP of 6.75, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-1-prop-1-en-2-ylpyrrolidine;ethane;3-methylpentane is sourced from PubChem (CID 177053875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).